About 5-ethylsulfanyl-N-methyl-1,3,4-thiadiazol-2-amine
5-ethylsulfanyl-N-methyl-1,3,4-thiadiazol-2-amine (PubChem CID 6453071) has the molecular formula C5H9N3S2
and a molecular weight of 175.28 g/mol. Its IUPAC name is 5-ethylsulfanyl-N-methyl-1,3,4-thiadiazol-2-amine.
Analyze 5-ethylsulfanyl-N-methyl-1,3,4-thiadiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethylsulfanyl-N-methyl-1,3,4-thiadiazol-2-amine?
The IUPAC name of 5-ethylsulfanyl-N-methyl-1,3,4-thiadiazol-2-amine (CID 6453071) is 5-ethylsulfanyl-N-methyl-1,3,4-thiadiazol-2-amine.
What is the SMILES notation for 5-ethylsulfanyl-N-methyl-1,3,4-thiadiazol-2-amine?
The canonical SMILES for 5-ethylsulfanyl-N-methyl-1,3,4-thiadiazol-2-amine is CCSc1nnc(NC)s1.
What is the InChIKey of 5-ethylsulfanyl-N-methyl-1,3,4-thiadiazol-2-amine?
The InChIKey is TVHNTVGLNZZCBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N3S2/c1-3-9-5-8-7-4(6-2)10-5/h3H2,1-2H3,(H,6,7).
What are the key properties of 5-ethylsulfanyl-N-methyl-1,3,4-thiadiazol-2-amine?
5-ethylsulfanyl-N-methyl-1,3,4-thiadiazol-2-amine has a molecular weight of 175.28 g/mol, XLogP of 1.69, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethylsulfanyl-N-methyl-1,3,4-thiadiazol-2-amine is sourced from PubChem (CID 6453071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).