C4H6N4O2S2 — CID 131089595
N-methyl-5-(nitromethylsulfanyl)-1,3,4-thiadiazol-2-amine (PubChem CID 131089595) has the molecular formula C4H6N4O2S2 and a molecular weight of 206.25 g/mol. Its IUPAC name is N-methyl-5-(nitromethylsulfanyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | N-methyl-5-(nitromethylsulfanyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 131089595 |
| Molecular Formula | C4H6N4O2S2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 205.99 |
| IUPAC Name | N-methyl-5-(nitromethylsulfanyl)-1,3,4-thiadiazol-2-amine |
| SMILES | CNc1nnc(SC[N+](=O)[O-])s1 |
| InChI | InChI=1S/C4H6N4O2S2/c1-5-3-6-7-4(12-3)11-2-8(9)10/h2H2,1H3,(H,5,6) |
| InChIKey | SCGWPHYCBKKVNM-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 80.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|