C9H19ClN4OS2 — CID 110190376
[2-hydroxy-3-[[5-(methylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propyl]-trimethylazanium chloride (PubChem CID 110190376) has the molecular formula C9H19ClN4OS2 and a molecular weight of 298.87 g/mol. Its IUPAC name is [2-hydroxy-3-[[5-(methylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propyl]-trimethylazanium chloride.
| Compound Name | [2-hydroxy-3-[[5-(methylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propyl]-trimethylazanium chloride |
|---|---|
| PubChem CID | 110190376 |
| Molecular Formula | C9H19ClN4OS2 |
| Molecular Weight | 298.87 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | [2-hydroxy-3-[[5-(methylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propyl]-trimethylazanium chloride |
| SMILES | CNc1nnc(SCC(O)C[N+](C)(C)C)s1.[Cl-] |
| InChI | InChI=1S/C9H19N4OS2.ClH/c1-10-8-11-12-9(16-8)15-6-7(14)5-13(2,3)4;/h7,14H,5-6H2,1-4H3,(H,10,11);1H/q+1;/p-1 |
| InChIKey | KLTMLGVBYYBQBK-UHFFFAOYSA-M |
| XLogP | -2.26 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.87 |
| LogP ≤ 5 | -2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|