C9H6F9N3OS2 — CID 71672657
N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-3,3,3-trifluoro-2,2-bis(trifluoromethyl)propanamide (PubChem CID 71672657) has the molecular formula C9H6F9N3OS2 and a molecular weight of 407.28 g/mol. Its IUPAC name is N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-3,3,3-trifluoro-2,2-bis(trifluoromethyl)propanamide.
| Compound Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-3,3,3-trifluoro-2,2-bis(trifluoromethyl)propanamide |
|---|---|
| PubChem CID | 71672657 |
| Molecular Formula | C9H6F9N3OS2 |
| Molecular Weight | 407.28 g/mol |
| Exact Mass | 406.98 |
| IUPAC Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-3,3,3-trifluoro-2,2-bis(trifluoromethyl)propanamide |
| SMILES | CCSc1nnc(NC(=O)C(C(F)(F)F)(C(F)(F)F)C(F)(F)F)s1 |
| InChI | InChI=1S/C9H6F9N3OS2/c1-2-23-5-21-20-4(24-5)19-3(22)6(7(10,11)12,8(13,14)15)9(16,17)18/h2H2,1H3,(H,19,20,22) |
| InChIKey | FOXQPZKKNAFJKW-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.28 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|