C9H12F3N3O2S2 — CID 38899434
(2R)-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-(2,2,2-trifluoroethoxy)propanamide (PubChem CID 38899434) has the molecular formula C9H12F3N3O2S2 and a molecular weight of 315.34 g/mol. Its IUPAC name is (2R)-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-(2,2,2-trifluoroethoxy)propanamide.
| Compound Name | (2R)-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-(2,2,2-trifluoroethoxy)propanamide |
|---|---|
| PubChem CID | 38899434 |
| Molecular Formula | C9H12F3N3O2S2 |
| Molecular Weight | 315.34 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | (2R)-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-(2,2,2-trifluoroethoxy)propanamide |
| SMILES | CCSc1nnc(NC(=O)[C@@H](C)OCC(F)(F)F)s1 |
| InChI | InChI=1S/C9H12F3N3O2S2/c1-3-18-8-15-14-7(19-8)13-6(16)5(2)17-4-9(10,11)12/h5H,3-4H2,1-2H3,(H,13,14,16)/t5-/m1/s1 |
| InChIKey | HCHXSLYGYSIUMZ-RXMQYKEDSA-N |
| XLogP | 2.56 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.34 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|