C20H28N4O2S2 — CID 3993230
4-tert-butyl-N-[1-[(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)amino]-3-methyl-1-oxobutan-2-yl]benzamide (PubChem CID 3993230) has the molecular formula C20H28N4O2S2 and a molecular weight of 420.60 g/mol. Its IUPAC name is 4-tert-butyl-N-[1-[(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)amino]-3-methyl-1-oxobutan-2-yl]benzamide.
| Compound Name | 4-tert-butyl-N-[1-[(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)amino]-3-methyl-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 3993230 |
| Molecular Formula | C20H28N4O2S2 |
| Molecular Weight | 420.60 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | 4-tert-butyl-N-[1-[(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)amino]-3-methyl-1-oxobutan-2-yl]benzamide |
| SMILES | CCSc1nnc(NC(=O)C(NC(=O)c2ccc(C(C)(C)C)cc2)C(C)C)s1 |
| InChI | InChI=1S/C20H28N4O2S2/c1-7-27-19-24-23-18(28-19)22-17(26)15(12(2)3)21-16(25)13-8-10-14(11-9-13)20(4,5)6/h8-12,15H,7H2,1-6H3,(H,21,25)(H,22,23,26) |
| InChIKey | AUTHTXBHWXVVRN-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.60 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|