C9H9F6N3OS2 — CID 658691
N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-3,3,3-trifluoro-2-methyl-2-(trifluoromethyl)propanamide (PubChem CID 658691) has the molecular formula C9H9F6N3OS2 and a molecular weight of 353.31 g/mol. Its IUPAC name is N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-3,3,3-trifluoro-2-methyl-2-(trifluoromethyl)propanamide.
| Compound Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-3,3,3-trifluoro-2-methyl-2-(trifluoromethyl)propanamide |
|---|---|
| PubChem CID | 658691 |
| Molecular Formula | C9H9F6N3OS2 |
| Molecular Weight | 353.31 g/mol |
| Exact Mass | 353.01 |
| IUPAC Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-3,3,3-trifluoro-2-methyl-2-(trifluoromethyl)propanamide |
| SMILES | CCSc1nnc(NC(=O)C(C)(C(F)(F)F)C(F)(F)F)s1 |
| InChI | InChI=1S/C9H9F6N3OS2/c1-3-20-6-18-17-5(21-6)16-4(19)7(2,8(10,11)12)9(13,14)15/h3H2,1-2H3,(H,16,17,19) |
| InChIKey | CACIMFREAFKQBY-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.31 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|