C11H6F13N3OS2 — CID 5097188
N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanamide (PubChem CID 5097188) has the molecular formula C11H6F13N3OS2 and a molecular weight of 507.30 g/mol. Its IUPAC name is N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanamide.
| Compound Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanamide |
|---|---|
| PubChem CID | 5097188 |
| Molecular Formula | C11H6F13N3OS2 |
| Molecular Weight | 507.30 g/mol |
| Exact Mass | 506.97 |
| IUPAC Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanamide |
| SMILES | CCSc1nnc(NC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)s1 |
| InChI | InChI=1S/C11H6F13N3OS2/c1-2-29-5-27-26-4(30-5)25-3(28)6(12,13)7(14,15)8(16,17)9(18,19)10(20,21)11(22,23)24/h2H2,1H3,(H,25,26,28) |
| InChIKey | FUMYWSSVIFYOTO-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.30 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|