C8H12N2S3 — CID 47094995
2-ethylsulfanyl-5-(2-methylprop-2-enylsulfanyl)-1,3,4-thiadiazole (PubChem CID 47094995) has the molecular formula C8H12N2S3 and a molecular weight of 232.40 g/mol. Its IUPAC name is 2-ethylsulfanyl-5-(2-methylprop-2-enylsulfanyl)-1,3,4-thiadiazole.
| Compound Name | 2-ethylsulfanyl-5-(2-methylprop-2-enylsulfanyl)-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 47094995 |
| Molecular Formula | C8H12N2S3 |
| Molecular Weight | 232.40 g/mol |
| Exact Mass | 232.02 |
| IUPAC Name | 2-ethylsulfanyl-5-(2-methylprop-2-enylsulfanyl)-1,3,4-thiadiazole |
| SMILES | C=C(C)CSc1nnc(SCC)s1 |
| InChI | InChI=1S/C8H12N2S3/c1-4-11-7-9-10-8(13-7)12-5-6(2)3/h2,4-5H2,1,3H3 |
| InChIKey | UWGZARSCYWLUAM-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.40 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|