C13H13ClN2S3 — CID 853221
2-[(4-chlorophenyl)methylsulfanyl]-5-(2-methylprop-2-enylsulfanyl)-1,3,4-thiadiazole (PubChem CID 853221) has the molecular formula C13H13ClN2S3 and a molecular weight of 328.92 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methylsulfanyl]-5-(2-methylprop-2-enylsulfanyl)-1,3,4-thiadiazole.
| Compound Name | 2-[(4-chlorophenyl)methylsulfanyl]-5-(2-methylprop-2-enylsulfanyl)-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 853221 |
| Molecular Formula | C13H13ClN2S3 |
| Molecular Weight | 328.92 g/mol |
| Exact Mass | 327.99 |
| IUPAC Name | 2-[(4-chlorophenyl)methylsulfanyl]-5-(2-methylprop-2-enylsulfanyl)-1,3,4-thiadiazole |
| SMILES | C=C(C)CSc1nnc(SCc2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C13H13ClN2S3/c1-9(2)7-17-12-15-16-13(19-12)18-8-10-3-5-11(14)6-4-10/h3-6H,1,7-8H2,2H3 |
| InChIKey | NCLVPQGTFVQZRN-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.92 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|