C11H15N3OS2 — CID 47142058
N-cyclopropyl-N-[5-(2-methylprop-2-enylsulfanyl)-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 47142058) has the molecular formula C11H15N3OS2 and a molecular weight of 269.39 g/mol. Its IUPAC name is N-cyclopropyl-N-[5-(2-methylprop-2-enylsulfanyl)-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | N-cyclopropyl-N-[5-(2-methylprop-2-enylsulfanyl)-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 47142058 |
| Molecular Formula | C11H15N3OS2 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | N-cyclopropyl-N-[5-(2-methylprop-2-enylsulfanyl)-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | C=C(C)CSc1nnc(N(C(C)=O)C2CC2)s1 |
| InChI | InChI=1S/C11H15N3OS2/c1-7(2)6-16-11-13-12-10(17-11)14(8(3)15)9-4-5-9/h9H,1,4-6H2,2-3H3 |
| InChIKey | QBDDUKAWCGNRKX-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|