C15H18N4O2S3 — CID 87019361
2-[[5-[acetyl(cyclopropyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[(3-methylthiophen-2-yl)methyl]acetamide (PubChem CID 87019361) has the molecular formula C15H18N4O2S3 and a molecular weight of 382.54 g/mol. Its IUPAC name is 2-[[5-[acetyl(cyclopropyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[(3-methylthiophen-2-yl)methyl]acetamide.
| Compound Name | 2-[[5-[acetyl(cyclopropyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[(3-methylthiophen-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 87019361 |
| Molecular Formula | C15H18N4O2S3 |
| Molecular Weight | 382.54 g/mol |
| Exact Mass | 382.06 |
| IUPAC Name | 2-[[5-[acetyl(cyclopropyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[(3-methylthiophen-2-yl)methyl]acetamide |
| SMILES | CC(=O)N(c1nnc(SCC(=O)NCc2sccc2C)s1)C1CC1 |
| InChI | InChI=1S/C15H18N4O2S3/c1-9-5-6-22-12(9)7-16-13(21)8-23-15-18-17-14(24-15)19(10(2)20)11-3-4-11/h5-6,11H,3-4,7-8H2,1-2H3,(H,16,21) |
| InChIKey | HPIJKXQVCTVDNR-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.54 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|