C15H15N5O2S3 — CID 8783324
N-[5-[2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-N-cyclopropylpropanamide (PubChem CID 8783324) has the molecular formula C15H15N5O2S3 and a molecular weight of 393.52 g/mol. Its IUPAC name is N-[5-[2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-N-cyclopropylpropanamide.
| Compound Name | N-[5-[2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-N-cyclopropylpropanamide |
|---|---|
| PubChem CID | 8783324 |
| Molecular Formula | C15H15N5O2S3 |
| Molecular Weight | 393.52 g/mol |
| Exact Mass | 393.04 |
| IUPAC Name | N-[5-[2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-N-cyclopropylpropanamide |
| SMILES | CCC(=O)N(c1nnc(SCC(=O)Nc2sccc2C#N)s1)C1CC1 |
| InChI | InChI=1S/C15H15N5O2S3/c1-2-12(22)20(10-3-4-10)14-18-19-15(25-14)24-8-11(21)17-13-9(7-16)5-6-23-13/h5-6,10H,2-4,8H2,1H3,(H,17,21) |
| InChIKey | IMJKQONUKPSTSI-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 98.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.52 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|