C21H20N4O3S2 — CID 33042952
2-[[5-[acetyl(cyclopropyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(4-phenoxyphenyl)acetamide (PubChem CID 33042952) has the molecular formula C21H20N4O3S2 and a molecular weight of 440.55 g/mol. Its IUPAC name is 2-[[5-[acetyl(cyclopropyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(4-phenoxyphenyl)acetamide.
| Compound Name | 2-[[5-[acetyl(cyclopropyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(4-phenoxyphenyl)acetamide |
|---|---|
| PubChem CID | 33042952 |
| Molecular Formula | C21H20N4O3S2 |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | 2-[[5-[acetyl(cyclopropyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(4-phenoxyphenyl)acetamide |
| SMILES | CC(=O)N(c1nnc(SCC(=O)Nc2ccc(Oc3ccccc3)cc2)s1)C1CC1 |
| InChI | InChI=1S/C21H20N4O3S2/c1-14(26)25(16-9-10-16)20-23-24-21(30-20)29-13-19(27)22-15-7-11-18(12-8-15)28-17-5-3-2-4-6-17/h2-8,11-12,16H,9-10,13H2,1H3,(H,22,27) |
| InChIKey | ZMPRULMSRIOVDS-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|