C22H22N4O3S2 — CID 42895834
2-[[5-[acetyl(cyclopropyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(4-methoxyphenyl)-2-phenylacetamide (PubChem CID 42895834) has the molecular formula C22H22N4O3S2 and a molecular weight of 454.58 g/mol. Its IUPAC name is 2-[[5-[acetyl(cyclopropyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(4-methoxyphenyl)-2-phenylacetamide.
| Compound Name | 2-[[5-[acetyl(cyclopropyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(4-methoxyphenyl)-2-phenylacetamide |
|---|---|
| PubChem CID | 42895834 |
| Molecular Formula | C22H22N4O3S2 |
| Molecular Weight | 454.58 g/mol |
| Exact Mass | 454.11 |
| IUPAC Name | 2-[[5-[acetyl(cyclopropyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(4-methoxyphenyl)-2-phenylacetamide |
| SMILES | COc1ccc(NC(=O)C(Sc2nnc(N(C(C)=O)C3CC3)s2)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H22N4O3S2/c1-14(27)26(17-10-11-17)21-24-25-22(31-21)30-19(15-6-4-3-5-7-15)20(28)23-16-8-12-18(29-2)13-9-16/h3-9,12-13,17,19H,10-11H2,1-2H3,(H,23,28) |
| InChIKey | MGIRVDHGTMCUOX-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.58 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|