C13H19N7OS2 — CID 32669779
N-[5-[(1-butyltetrazol-5-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-N-cyclopropylacetamide (PubChem CID 32669779) has the molecular formula C13H19N7OS2 and a molecular weight of 353.48 g/mol. Its IUPAC name is N-[5-[(1-butyltetrazol-5-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-N-cyclopropylacetamide.
| Compound Name | N-[5-[(1-butyltetrazol-5-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-N-cyclopropylacetamide |
|---|---|
| PubChem CID | 32669779 |
| Molecular Formula | C13H19N7OS2 |
| Molecular Weight | 353.48 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | N-[5-[(1-butyltetrazol-5-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-N-cyclopropylacetamide |
| SMILES | CCCCn1nnnc1CSc1nnc(N(C(C)=O)C2CC2)s1 |
| InChI | InChI=1S/C13H19N7OS2/c1-3-4-7-19-11(14-17-18-19)8-22-13-16-15-12(23-13)20(9(2)21)10-5-6-10/h10H,3-8H2,1-2H3 |
| InChIKey | XYBOHBOZNKOLKR-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 89.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.48 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|