C20H32S2 — CID 59265645
3,6-dihexyl-2,5-dimethylthieno[3,2-b]thiophene (PubChem CID 59265645) has the molecular formula C20H32S2 and a molecular weight of 336.61 g/mol. Its IUPAC name is 3,6-dihexyl-2,5-dimethylthieno[3,2-b]thiophene.
| Compound Name | 3,6-dihexyl-2,5-dimethylthieno[3,2-b]thiophene |
|---|---|
| PubChem CID | 59265645 |
| Molecular Formula | C20H32S2 |
| Molecular Weight | 336.61 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | 3,6-dihexyl-2,5-dimethylthieno[3,2-b]thiophene |
| SMILES | CCCCCCc1c(C)sc2c(CCCCCC)c(C)sc12 |
| InChI | InChI=1S/C20H32S2/c1-5-7-9-11-13-17-15(3)21-20-18(14-12-10-8-6-2)16(4)22-19(17)20/h5-14H2,1-4H3 |
| InChIKey | YHXGXPFHJFWBRK-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.61 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|