C14H24BrNS — CID 147585581
5-bromo-2-undecyl-1,3-thiazole (PubChem CID 147585581) has the molecular formula C14H24BrNS and a molecular weight of 318.32 g/mol. Its IUPAC name is 5-bromo-2-undecyl-1,3-thiazole.
| Compound Name | 5-bromo-2-undecyl-1,3-thiazole |
|---|---|
| PubChem CID | 147585581 |
| Molecular Formula | C14H24BrNS |
| Molecular Weight | 318.32 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | 5-bromo-2-undecyl-1,3-thiazole |
| SMILES | CCCCCCCCCCCc1ncc(Br)s1 |
| InChI | InChI=1S/C14H24BrNS/c1-2-3-4-5-6-7-8-9-10-11-14-16-12-13(15)17-14/h12H,2-11H2,1H3 |
| InChIKey | FXGOKRZHOVVJKM-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.32 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|