C7H10BrNS2 — CID 117188294
5-bromo-2-(propan-2-ylsulfanylmethyl)-1,3-thiazole (PubChem CID 117188294) has the molecular formula C7H10BrNS2 and a molecular weight of 252.20 g/mol. Its IUPAC name is 5-bromo-2-(propan-2-ylsulfanylmethyl)-1,3-thiazole.
| Compound Name | 5-bromo-2-(propan-2-ylsulfanylmethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 117188294 |
| Molecular Formula | C7H10BrNS2 |
| Molecular Weight | 252.20 g/mol |
| Exact Mass | 250.94 |
| IUPAC Name | 5-bromo-2-(propan-2-ylsulfanylmethyl)-1,3-thiazole |
| SMILES | CC(C)SCc1ncc(Br)s1 |
| InChI | InChI=1S/C7H10BrNS2/c1-5(2)10-4-7-9-3-6(8)11-7/h3,5H,4H2,1-2H3 |
| InChIKey | WWQGFILFUAANPH-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.20 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |