About 5-methyl-2-(2-methylpropylsulfanylmethyl)-1,3-thiazole
5-methyl-2-(2-methylpropylsulfanylmethyl)-1,3-thiazole (PubChem CID 115886779) has the molecular formula C9H15NS2
and a molecular weight of 201.36 g/mol. Its IUPAC name is 5-methyl-2-(2-methylpropylsulfanylmethyl)-1,3-thiazole.
Analyze 5-methyl-2-(2-methylpropylsulfanylmethyl)-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2-(2-methylpropylsulfanylmethyl)-1,3-thiazole?
The IUPAC name of 5-methyl-2-(2-methylpropylsulfanylmethyl)-1,3-thiazole (CID 115886779) is 5-methyl-2-(2-methylpropylsulfanylmethyl)-1,3-thiazole.
What is the SMILES notation for 5-methyl-2-(2-methylpropylsulfanylmethyl)-1,3-thiazole?
The canonical SMILES for 5-methyl-2-(2-methylpropylsulfanylmethyl)-1,3-thiazole is Cc1cnc(CSCC(C)C)s1.
What is the InChIKey of 5-methyl-2-(2-methylpropylsulfanylmethyl)-1,3-thiazole?
The InChIKey is DQXDBVHIPJIWPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NS2/c1-7(2)5-11-6-9-10-4-8(3)12-9/h4,7H,5-6H2,1-3H3.
What are the key properties of 5-methyl-2-(2-methylpropylsulfanylmethyl)-1,3-thiazole?
5-methyl-2-(2-methylpropylsulfanylmethyl)-1,3-thiazole has a molecular weight of 201.36 g/mol, XLogP of 3.34, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2-(2-methylpropylsulfanylmethyl)-1,3-thiazole is sourced from PubChem (CID 115886779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).