C9H16N4S — CID 103062043
[5-(2-methylpropylsulfanylmethyl)pyrazin-2-yl]hydrazine (PubChem CID 103062043) has the molecular formula C9H16N4S and a molecular weight of 212.32 g/mol. Its IUPAC name is [5-(2-methylpropylsulfanylmethyl)pyrazin-2-yl]hydrazine.
| Compound Name | [5-(2-methylpropylsulfanylmethyl)pyrazin-2-yl]hydrazine |
|---|---|
| PubChem CID | 103062043 |
| Molecular Formula | C9H16N4S |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | [5-(2-methylpropylsulfanylmethyl)pyrazin-2-yl]hydrazine |
| SMILES | CC(C)CSCc1cnc(NN)cn1 |
| InChI | InChI=1S/C9H16N4S/c1-7(2)5-14-6-8-3-12-9(13-10)4-11-8/h3-4,7H,5-6,10H2,1-2H3,(H,12,13) |
| InChIKey | GSQMJPFMPZYXLW-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|