C7H12N4 — CID 123407613
(5-propylpyrazin-2-yl)hydrazine (PubChem CID 123407613) has the molecular formula C7H12N4 and a molecular weight of 152.20 g/mol. Its IUPAC name is (5-propylpyrazin-2-yl)hydrazine.
| Compound Name | (5-propylpyrazin-2-yl)hydrazine |
|---|---|
| PubChem CID | 123407613 |
| Molecular Formula | C7H12N4 |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.11 |
| IUPAC Name | (5-propylpyrazin-2-yl)hydrazine |
| SMILES | CCCc1cnc(NN)cn1 |
| InChI | InChI=1S/C7H12N4/c1-2-3-6-4-10-7(11-8)5-9-6/h4-5H,2-3,8H2,1H3,(H,10,11) |
| InChIKey | LNNALASGHHOAHJ-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|