About [5-[(4,4-diethylpiperidin-1-yl)methyl]pyrazin-2-yl]hydrazine
[5-[(4,4-diethylpiperidin-1-yl)methyl]pyrazin-2-yl]hydrazine (PubChem CID 103060957) has the molecular formula C14H25N5
and a molecular weight of 263.39 g/mol. Its IUPAC name is [5-[(4,4-diethylpiperidin-1-yl)methyl]pyrazin-2-yl]hydrazine.
Molecular Properties
| Compound Name | [5-[(4,4-diethylpiperidin-1-yl)methyl]pyrazin-2-yl]hydrazine |
| PubChem CID | 103060957 |
| Molecular Formula | C14H25N5 |
| Molecular Weight | 263.39 g/mol |
| Exact Mass | 263.21 |
| IUPAC Name | [5-[(4,4-diethylpiperidin-1-yl)methyl]pyrazin-2-yl]hydrazine |
| SMILES | CCC1(CC)CCN(Cc2cnc(NN)cn2)CC1 |
| InChI | InChI=1S/C14H25N5/c1-3-14(4-2)5-7-19(8-6-14)11-12-9-17-13(18-15)10-16-12/h9-10H,3-8,11,15H2,1-2H3,(H,17,18) |
| InChIKey | JUILEGAZNMFPTO-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.39 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [5-[(4,4-diethylpiperidin-1-yl)methyl]pyrazin-2-yl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-[(4,4-diethylpiperidin-1-yl)methyl]pyrazin-2-yl]hydrazine?
The IUPAC name of [5-[(4,4-diethylpiperidin-1-yl)methyl]pyrazin-2-yl]hydrazine (CID 103060957) is [5-[(4,4-diethylpiperidin-1-yl)methyl]pyrazin-2-yl]hydrazine.
What is the SMILES notation for [5-[(4,4-diethylpiperidin-1-yl)methyl]pyrazin-2-yl]hydrazine?
The canonical SMILES for [5-[(4,4-diethylpiperidin-1-yl)methyl]pyrazin-2-yl]hydrazine is CCC1(CC)CCN(Cc2cnc(NN)cn2)CC1.
What is the InChIKey of [5-[(4,4-diethylpiperidin-1-yl)methyl]pyrazin-2-yl]hydrazine?
The InChIKey is JUILEGAZNMFPTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25N5/c1-3-14(4-2)5-7-19(8-6-14)11-12-9-17-13(18-15)10-16-12/h9-10H,3-8,11,15H2,1-2H3,(H,17,18).
What are the key properties of [5-[(4,4-diethylpiperidin-1-yl)methyl]pyrazin-2-yl]hydrazine?
[5-[(4,4-diethylpiperidin-1-yl)methyl]pyrazin-2-yl]hydrazine has a molecular weight of 263.39 g/mol, XLogP of 2.16, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-[(4,4-diethylpiperidin-1-yl)methyl]pyrazin-2-yl]hydrazine is sourced from PubChem (CID 103060957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).