C11H19N5 — CID 103061017
N-(cyclopropylmethyl)-N-[(5-hydrazinylpyrazin-2-yl)methyl]ethanamine (PubChem CID 103061017) has the molecular formula C11H19N5 and a molecular weight of 221.31 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-N-[(5-hydrazinylpyrazin-2-yl)methyl]ethanamine.
| Compound Name | N-(cyclopropylmethyl)-N-[(5-hydrazinylpyrazin-2-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 103061017 |
| Molecular Formula | C11H19N5 |
| Molecular Weight | 221.31 g/mol |
| Exact Mass | 221.16 |
| IUPAC Name | N-(cyclopropylmethyl)-N-[(5-hydrazinylpyrazin-2-yl)methyl]ethanamine |
| SMILES | CCN(Cc1cnc(NN)cn1)CC1CC1 |
| InChI | InChI=1S/C11H19N5/c1-2-16(7-9-3-4-9)8-10-5-14-11(15-12)6-13-10/h5-6,9H,2-4,7-8,12H2,1H3,(H,14,15) |
| InChIKey | DOSGBNQOJOHWAJ-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.31 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|