C11H20N6O — CID 103060559
2-[butyl-[(5-hydrazinylpyrazin-2-yl)methyl]amino]acetamide (PubChem CID 103060559) has the molecular formula C11H20N6O and a molecular weight of 252.32 g/mol. Its IUPAC name is 2-[butyl-[(5-hydrazinylpyrazin-2-yl)methyl]amino]acetamide.
| Compound Name | 2-[butyl-[(5-hydrazinylpyrazin-2-yl)methyl]amino]acetamide |
|---|---|
| PubChem CID | 103060559 |
| Molecular Formula | C11H20N6O |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | 2-[butyl-[(5-hydrazinylpyrazin-2-yl)methyl]amino]acetamide |
| SMILES | CCCCN(CC(N)=O)Cc1cnc(NN)cn1 |
| InChI | InChI=1S/C11H20N6O/c1-2-3-4-17(8-10(12)18)7-9-5-15-11(16-13)6-14-9/h5-6H,2-4,7-8,13H2,1H3,(H2,12,18)(H,15,16) |
| InChIKey | YNGJWQOCOUTHTB-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 110.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|