About N-[(5-hydrazinylpyrazin-2-yl)methyl]-N,3-dimethylbutan-1-amine
N-[(5-hydrazinylpyrazin-2-yl)methyl]-N,3-dimethylbutan-1-amine (PubChem CID 103060692) has the molecular formula C11H21N5
and a molecular weight of 223.32 g/mol. Its IUPAC name is N-[(5-hydrazinylpyrazin-2-yl)methyl]-N,3-dimethylbutan-1-amine.
Molecular Properties
| Compound Name | N-[(5-hydrazinylpyrazin-2-yl)methyl]-N,3-dimethylbutan-1-amine |
| PubChem CID | 103060692 |
| Molecular Formula | C11H21N5 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.18 |
| IUPAC Name | N-[(5-hydrazinylpyrazin-2-yl)methyl]-N,3-dimethylbutan-1-amine |
| SMILES | CC(C)CCN(C)Cc1cnc(NN)cn1 |
| InChI | InChI=1S/C11H21N5/c1-9(2)4-5-16(3)8-10-6-14-11(15-12)7-13-10/h6-7,9H,4-5,8,12H2,1-3H3,(H,14,15) |
| InChIKey | OZZWBPCWOGRLRL-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(5-hydrazinylpyrazin-2-yl)methyl]-N,3-dimethylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(5-hydrazinylpyrazin-2-yl)methyl]-N,3-dimethylbutan-1-amine?
The IUPAC name of N-[(5-hydrazinylpyrazin-2-yl)methyl]-N,3-dimethylbutan-1-amine (CID 103060692) is N-[(5-hydrazinylpyrazin-2-yl)methyl]-N,3-dimethylbutan-1-amine.
What is the SMILES notation for N-[(5-hydrazinylpyrazin-2-yl)methyl]-N,3-dimethylbutan-1-amine?
The canonical SMILES for N-[(5-hydrazinylpyrazin-2-yl)methyl]-N,3-dimethylbutan-1-amine is CC(C)CCN(C)Cc1cnc(NN)cn1.
What is the InChIKey of N-[(5-hydrazinylpyrazin-2-yl)methyl]-N,3-dimethylbutan-1-amine?
The InChIKey is OZZWBPCWOGRLRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N5/c1-9(2)4-5-16(3)8-10-6-14-11(15-12)7-13-10/h6-7,9H,4-5,8,12H2,1-3H3,(H,14,15).
What are the key properties of N-[(5-hydrazinylpyrazin-2-yl)methyl]-N,3-dimethylbutan-1-amine?
N-[(5-hydrazinylpyrazin-2-yl)methyl]-N,3-dimethylbutan-1-amine has a molecular weight of 223.32 g/mol, XLogP of 1.24, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(5-hydrazinylpyrazin-2-yl)methyl]-N,3-dimethylbutan-1-amine is sourced from PubChem (CID 103060692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).