C13H16BrN5 — CID 103060724
1-(4-bromophenyl)-N-[(5-hydrazinylpyrazin-2-yl)methyl]-N-methylmethanamine (PubChem CID 103060724) has the molecular formula C13H16BrN5 and a molecular weight of 322.21 g/mol. Its IUPAC name is 1-(4-bromophenyl)-N-[(5-hydrazinylpyrazin-2-yl)methyl]-N-methylmethanamine.
| Compound Name | 1-(4-bromophenyl)-N-[(5-hydrazinylpyrazin-2-yl)methyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 103060724 |
| Molecular Formula | C13H16BrN5 |
| Molecular Weight | 322.21 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | 1-(4-bromophenyl)-N-[(5-hydrazinylpyrazin-2-yl)methyl]-N-methylmethanamine |
| SMILES | CN(Cc1ccc(Br)cc1)Cc1cnc(NN)cn1 |
| InChI | InChI=1S/C13H16BrN5/c1-19(8-10-2-4-11(14)5-3-10)9-12-6-17-13(18-15)7-16-12/h2-7H,8-9,15H2,1H3,(H,17,18) |
| InChIKey | SFVNUANPFDUTDM-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.21 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|