C9H17N5S — CID 103061186
N-[(5-hydrazinylpyrazin-2-yl)methyl]-N-methyl-2-methylsulfanylethanamine (PubChem CID 103061186) has the molecular formula C9H17N5S and a molecular weight of 227.34 g/mol. Its IUPAC name is N-[(5-hydrazinylpyrazin-2-yl)methyl]-N-methyl-2-methylsulfanylethanamine.
| Compound Name | N-[(5-hydrazinylpyrazin-2-yl)methyl]-N-methyl-2-methylsulfanylethanamine |
|---|---|
| PubChem CID | 103061186 |
| Molecular Formula | C9H17N5S |
| Molecular Weight | 227.34 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | N-[(5-hydrazinylpyrazin-2-yl)methyl]-N-methyl-2-methylsulfanylethanamine |
| SMILES | CSCCN(C)Cc1cnc(NN)cn1 |
| InChI | InChI=1S/C9H17N5S/c1-14(3-4-15-2)7-8-5-12-9(13-10)6-11-8/h5-6H,3-4,7,10H2,1-2H3,(H,12,13) |
| InChIKey | UBNLWAPUOLHZJA-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.34 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|