C10H14N6S — CID 103060502
1-(5-hydrazinylpyrazin-2-yl)-N-methyl-N-(1,3-thiazol-4-ylmethyl)methanamine (PubChem CID 103060502) has the molecular formula C10H14N6S and a molecular weight of 250.33 g/mol. Its IUPAC name is 1-(5-hydrazinylpyrazin-2-yl)-N-methyl-N-(1,3-thiazol-4-ylmethyl)methanamine.
| Compound Name | 1-(5-hydrazinylpyrazin-2-yl)-N-methyl-N-(1,3-thiazol-4-ylmethyl)methanamine |
|---|---|
| PubChem CID | 103060502 |
| Molecular Formula | C10H14N6S |
| Molecular Weight | 250.33 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 1-(5-hydrazinylpyrazin-2-yl)-N-methyl-N-(1,3-thiazol-4-ylmethyl)methanamine |
| SMILES | CN(Cc1cnc(NN)cn1)Cc1cscn1 |
| InChI | InChI=1S/C10H14N6S/c1-16(5-9-6-17-7-14-9)4-8-2-13-10(15-11)3-12-8/h2-3,6-7H,4-5,11H2,1H3,(H,13,15) |
| InChIKey | FXHPCSRJUAASEP-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 79.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.33 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|