C9H15F2N5O — CID 107486351
2-[2,2-difluoroethyl-[(5-hydrazinylpyrazin-2-yl)methyl]amino]ethanol (PubChem CID 107486351) has the molecular formula C9H15F2N5O and a molecular weight of 247.25 g/mol. Its IUPAC name is 2-[2,2-difluoroethyl-[(5-hydrazinylpyrazin-2-yl)methyl]amino]ethanol.
| Compound Name | 2-[2,2-difluoroethyl-[(5-hydrazinylpyrazin-2-yl)methyl]amino]ethanol |
|---|---|
| PubChem CID | 107486351 |
| Molecular Formula | C9H15F2N5O |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 2-[2,2-difluoroethyl-[(5-hydrazinylpyrazin-2-yl)methyl]amino]ethanol |
| SMILES | NNc1cnc(CN(CCO)CC(F)F)cn1 |
| InChI | InChI=1S/C9H15F2N5O/c10-8(11)6-16(1-2-17)5-7-3-14-9(15-12)4-13-7/h3-4,8,17H,1-2,5-6,12H2,(H,14,15) |
| InChIKey | YQVVOSKAQHFZEG-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|