C9H16N4OS — CID 103062099
[5-(3-methoxypropylsulfanylmethyl)pyrazin-2-yl]hydrazine (PubChem CID 103062099) has the molecular formula C9H16N4OS and a molecular weight of 228.32 g/mol. Its IUPAC name is [5-(3-methoxypropylsulfanylmethyl)pyrazin-2-yl]hydrazine.
| Compound Name | [5-(3-methoxypropylsulfanylmethyl)pyrazin-2-yl]hydrazine |
|---|---|
| PubChem CID | 103062099 |
| Molecular Formula | C9H16N4OS |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | [5-(3-methoxypropylsulfanylmethyl)pyrazin-2-yl]hydrazine |
| SMILES | COCCCSCc1cnc(NN)cn1 |
| InChI | InChI=1S/C9H16N4OS/c1-14-3-2-4-15-7-8-5-12-9(13-10)6-11-8/h5-6H,2-4,7,10H2,1H3,(H,12,13) |
| InChIKey | RRETZZATFVKRIZ-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|