C14H18N4S — CID 103062114
[5-[(3,5-dimethylphenyl)methylsulfanylmethyl]pyrazin-2-yl]hydrazine (PubChem CID 103062114) has the molecular formula C14H18N4S and a molecular weight of 274.39 g/mol. Its IUPAC name is [5-[(3,5-dimethylphenyl)methylsulfanylmethyl]pyrazin-2-yl]hydrazine.
| Compound Name | [5-[(3,5-dimethylphenyl)methylsulfanylmethyl]pyrazin-2-yl]hydrazine |
|---|---|
| PubChem CID | 103062114 |
| Molecular Formula | C14H18N4S |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | [5-[(3,5-dimethylphenyl)methylsulfanylmethyl]pyrazin-2-yl]hydrazine |
| SMILES | Cc1cc(C)cc(CSCc2cnc(NN)cn2)c1 |
| InChI | InChI=1S/C14H18N4S/c1-10-3-11(2)5-12(4-10)8-19-9-13-6-17-14(18-15)7-16-13/h3-7H,8-9,15H2,1-2H3,(H,17,18) |
| InChIKey | KHGDZSFTRYBWSN-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|