About [5-[(3,5-dimethylphenyl)methylsulfanyl]-2-pyridinyl]methanamine
[5-[(3,5-dimethylphenyl)methylsulfanyl]-2-pyridinyl]methanamine (PubChem CID 113321432) has the molecular formula C15H18N2S
and a molecular weight of 258.39 g/mol. Its IUPAC name is [5-[(3,5-dimethylphenyl)methylsulfanyl]-2-pyridinyl]methanamine.
Molecular Properties
| Compound Name | [5-[(3,5-dimethylphenyl)methylsulfanyl]-2-pyridinyl]methanamine |
| PubChem CID | 113321432 |
| Molecular Formula | C15H18N2S |
| Molecular Weight | 258.39 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | [5-[(3,5-dimethylphenyl)methylsulfanyl]-2-pyridinyl]methanamine |
| SMILES | Cc1cc(C)cc(CSc2ccc(CN)nc2)c1 |
| InChI | InChI=1S/C15H18N2S/c1-11-5-12(2)7-13(6-11)10-18-15-4-3-14(8-16)17-9-15/h3-7,9H,8,10,16H2,1-2H3 |
| InChIKey | SKQVSORGHLXJEC-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.39 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [5-[(3,5-dimethylphenyl)methylsulfanyl]-2-pyridinyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-[(3,5-dimethylphenyl)methylsulfanyl]-2-pyridinyl]methanamine?
The IUPAC name of [5-[(3,5-dimethylphenyl)methylsulfanyl]-2-pyridinyl]methanamine (CID 113321432) is [5-[(3,5-dimethylphenyl)methylsulfanyl]-2-pyridinyl]methanamine.
What is the SMILES notation for [5-[(3,5-dimethylphenyl)methylsulfanyl]-2-pyridinyl]methanamine?
The canonical SMILES for [5-[(3,5-dimethylphenyl)methylsulfanyl]-2-pyridinyl]methanamine is Cc1cc(C)cc(CSc2ccc(CN)nc2)c1.
What is the InChIKey of [5-[(3,5-dimethylphenyl)methylsulfanyl]-2-pyridinyl]methanamine?
The InChIKey is SKQVSORGHLXJEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2S/c1-11-5-12(2)7-13(6-11)10-18-15-4-3-14(8-16)17-9-15/h3-7,9H,8,10,16H2,1-2H3.
What are the key properties of [5-[(3,5-dimethylphenyl)methylsulfanyl]-2-pyridinyl]methanamine?
[5-[(3,5-dimethylphenyl)methylsulfanyl]-2-pyridinyl]methanamine has a molecular weight of 258.39 g/mol, XLogP of 3.45, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [5-[(3,5-dimethylphenyl)methylsulfanyl]-2-pyridinyl]methanamine is sourced from PubChem (CID 113321432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).