About [2-bromo-6-[(3,5-dimethylphenyl)methylsulfanyl]phenyl]methanamine
[2-bromo-6-[(3,5-dimethylphenyl)methylsulfanyl]phenyl]methanamine (PubChem CID 114884689) has the molecular formula C16H18BrNS
and a molecular weight of 336.30 g/mol. Its IUPAC name is [2-bromo-6-[(3,5-dimethylphenyl)methylsulfanyl]phenyl]methanamine.
Molecular Properties
| Compound Name | [2-bromo-6-[(3,5-dimethylphenyl)methylsulfanyl]phenyl]methanamine |
| PubChem CID | 114884689 |
| Molecular Formula | C16H18BrNS |
| Molecular Weight | 336.30 g/mol |
| Exact Mass | 335.03 |
| IUPAC Name | [2-bromo-6-[(3,5-dimethylphenyl)methylsulfanyl]phenyl]methanamine |
| SMILES | Cc1cc(C)cc(CSc2cccc(Br)c2CN)c1 |
| InChI | InChI=1S/C16H18BrNS/c1-11-6-12(2)8-13(7-11)10-19-16-5-3-4-15(17)14(16)9-18/h3-8H,9-10,18H2,1-2H3 |
| InChIKey | WGOJAXFOTVNKIL-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.30 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [2-bromo-6-[(3,5-dimethylphenyl)methylsulfanyl]phenyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-bromo-6-[(3,5-dimethylphenyl)methylsulfanyl]phenyl]methanamine?
The IUPAC name of [2-bromo-6-[(3,5-dimethylphenyl)methylsulfanyl]phenyl]methanamine (CID 114884689) is [2-bromo-6-[(3,5-dimethylphenyl)methylsulfanyl]phenyl]methanamine.
What is the SMILES notation for [2-bromo-6-[(3,5-dimethylphenyl)methylsulfanyl]phenyl]methanamine?
The canonical SMILES for [2-bromo-6-[(3,5-dimethylphenyl)methylsulfanyl]phenyl]methanamine is Cc1cc(C)cc(CSc2cccc(Br)c2CN)c1.
What is the InChIKey of [2-bromo-6-[(3,5-dimethylphenyl)methylsulfanyl]phenyl]methanamine?
The InChIKey is WGOJAXFOTVNKIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18BrNS/c1-11-6-12(2)8-13(7-11)10-19-16-5-3-4-15(17)14(16)9-18/h3-8H,9-10,18H2,1-2H3.
What are the key properties of [2-bromo-6-[(3,5-dimethylphenyl)methylsulfanyl]phenyl]methanamine?
[2-bromo-6-[(3,5-dimethylphenyl)methylsulfanyl]phenyl]methanamine has a molecular weight of 336.30 g/mol, XLogP of 4.82, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2-bromo-6-[(3,5-dimethylphenyl)methylsulfanyl]phenyl]methanamine is sourced from PubChem (CID 114884689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).