C10H18N2S — CID 3249621
N-methyl-1-(5-pentyl-1,3-thiazol-2-yl)methanamine (PubChem CID 3249621) has the molecular formula C10H18N2S and a molecular weight of 198.33 g/mol. Its IUPAC name is N-methyl-1-(5-pentyl-1,3-thiazol-2-yl)methanamine.
| Compound Name | N-methyl-1-(5-pentyl-1,3-thiazol-2-yl)methanamine |
|---|---|
| PubChem CID | 3249621 |
| Molecular Formula | C10H18N2S |
| Molecular Weight | 198.33 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | N-methyl-1-(5-pentyl-1,3-thiazol-2-yl)methanamine |
| SMILES | CCCCCc1cnc(CNC)s1 |
| InChI | InChI=1S/C10H18N2S/c1-3-4-5-6-9-7-12-10(13-9)8-11-2/h7,11H,3-6,8H2,1-2H3 |
| InChIKey | VTFSMMHLNFRCSO-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.33 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|