C7H12N2S — CID 83682105
2-(2-ethyl-1,3-thiazol-5-yl)ethanamine (PubChem CID 83682105) has the molecular formula C7H12N2S and a molecular weight of 156.25 g/mol. Its IUPAC name is 2-(2-ethyl-1,3-thiazol-5-yl)ethanamine.
| Compound Name | 2-(2-ethyl-1,3-thiazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 83682105 |
| Molecular Formula | C7H12N2S |
| Molecular Weight | 156.25 g/mol |
| Exact Mass | 156.07 |
| IUPAC Name | 2-(2-ethyl-1,3-thiazol-5-yl)ethanamine |
| SMILES | CCc1ncc(CCN)s1 |
| InChI | InChI=1S/C7H12N2S/c1-2-7-9-5-6(10-7)3-4-8/h5H,2-4,8H2,1H3 |
| InChIKey | BOSBOCNWPFTZDR-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.25 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |