C12H14N2OS — CID 94686224
2-[2-(phenoxymethyl)-1,3-thiazol-5-yl]ethanamine (PubChem CID 94686224) has the molecular formula C12H14N2OS and a molecular weight of 234.32 g/mol. Its IUPAC name is 2-[2-(phenoxymethyl)-1,3-thiazol-5-yl]ethanamine.
| Compound Name | 2-[2-(phenoxymethyl)-1,3-thiazol-5-yl]ethanamine |
|---|---|
| PubChem CID | 94686224 |
| Molecular Formula | C12H14N2OS |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 2-[2-(phenoxymethyl)-1,3-thiazol-5-yl]ethanamine |
| SMILES | NCCc1cnc(COc2ccccc2)s1 |
| InChI | InChI=1S/C12H14N2OS/c13-7-6-11-8-14-12(16-11)9-15-10-4-2-1-3-5-10/h1-5,8H,6-7,9,13H2 |
| InChIKey | MOJHJCBRIIJPIM-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |