C11H10ClNO2S — CID 82190969
[2-[(4-chlorophenoxy)methyl]-1,3-thiazol-5-yl]methanol (PubChem CID 82190969) has the molecular formula C11H10ClNO2S and a molecular weight of 255.73 g/mol. Its IUPAC name is [2-[(4-chlorophenoxy)methyl]-1,3-thiazol-5-yl]methanol.
| Compound Name | [2-[(4-chlorophenoxy)methyl]-1,3-thiazol-5-yl]methanol |
|---|---|
| PubChem CID | 82190969 |
| Molecular Formula | C11H10ClNO2S |
| Molecular Weight | 255.73 g/mol |
| Exact Mass | 255.01 |
| IUPAC Name | [2-[(4-chlorophenoxy)methyl]-1,3-thiazol-5-yl]methanol |
| SMILES | OCc1cnc(COc2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C11H10ClNO2S/c12-8-1-3-9(4-2-8)15-7-11-13-5-10(6-14)16-11/h1-5,14H,6-7H2 |
| InChIKey | NFFFLRGFNQSIAV-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.73 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |