C12H13BrN2OS — CID 94721333
2-[2-[(4-bromophenoxy)methyl]-1,3-thiazol-5-yl]ethanamine (PubChem CID 94721333) has the molecular formula C12H13BrN2OS and a molecular weight of 313.22 g/mol. Its IUPAC name is 2-[2-[(4-bromophenoxy)methyl]-1,3-thiazol-5-yl]ethanamine.
| Compound Name | 2-[2-[(4-bromophenoxy)methyl]-1,3-thiazol-5-yl]ethanamine |
|---|---|
| PubChem CID | 94721333 |
| Molecular Formula | C12H13BrN2OS |
| Molecular Weight | 313.22 g/mol |
| Exact Mass | 311.99 |
| IUPAC Name | 2-[2-[(4-bromophenoxy)methyl]-1,3-thiazol-5-yl]ethanamine |
| SMILES | NCCc1cnc(COc2ccc(Br)cc2)s1 |
| InChI | InChI=1S/C12H13BrN2OS/c13-9-1-3-10(4-2-9)16-8-12-15-7-11(17-12)5-6-14/h1-4,7H,5-6,8,14H2 |
| InChIKey | USMGHAQFRHDICG-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.22 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |