C15H19FN2OS — CID 82423033
N-[[2-[(4-fluorophenoxy)methyl]-1,3-thiazol-5-yl]methyl]butan-1-amine (PubChem CID 82423033) has the molecular formula C15H19FN2OS and a molecular weight of 294.39 g/mol. Its IUPAC name is N-[[2-[(4-fluorophenoxy)methyl]-1,3-thiazol-5-yl]methyl]butan-1-amine.
| Compound Name | N-[[2-[(4-fluorophenoxy)methyl]-1,3-thiazol-5-yl]methyl]butan-1-amine |
|---|---|
| PubChem CID | 82423033 |
| Molecular Formula | C15H19FN2OS |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | N-[[2-[(4-fluorophenoxy)methyl]-1,3-thiazol-5-yl]methyl]butan-1-amine |
| SMILES | CCCCNCc1cnc(COc2ccc(F)cc2)s1 |
| InChI | InChI=1S/C15H19FN2OS/c1-2-3-8-17-9-14-10-18-15(20-14)11-19-13-6-4-12(16)5-7-13/h4-7,10,17H,2-3,8-9,11H2,1H3 |
| InChIKey | SKEKAWNVWJCOIV-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|