C17H24N2OS — CID 82422878
N-[[2-[(3-ethylphenoxy)methyl]-1,3-thiazol-5-yl]methyl]butan-1-amine (PubChem CID 82422878) has the molecular formula C17H24N2OS and a molecular weight of 304.46 g/mol. Its IUPAC name is N-[[2-[(3-ethylphenoxy)methyl]-1,3-thiazol-5-yl]methyl]butan-1-amine.
| Compound Name | N-[[2-[(3-ethylphenoxy)methyl]-1,3-thiazol-5-yl]methyl]butan-1-amine |
|---|---|
| PubChem CID | 82422878 |
| Molecular Formula | C17H24N2OS |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | N-[[2-[(3-ethylphenoxy)methyl]-1,3-thiazol-5-yl]methyl]butan-1-amine |
| SMILES | CCCCNCc1cnc(COc2cccc(CC)c2)s1 |
| InChI | InChI=1S/C17H24N2OS/c1-3-5-9-18-11-16-12-19-17(21-16)13-20-15-8-6-7-14(4-2)10-15/h6-8,10,12,18H,3-5,9,11,13H2,1-2H3 |
| InChIKey | HBSZVOUZZWADIE-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|