C11H11ClN2OS — CID 82298972
[2-[(2-chlorophenoxy)methyl]-1,3-thiazol-5-yl]methanamine (PubChem CID 82298972) has the molecular formula C11H11ClN2OS and a molecular weight of 254.74 g/mol. Its IUPAC name is [2-[(2-chlorophenoxy)methyl]-1,3-thiazol-5-yl]methanamine.
| Compound Name | [2-[(2-chlorophenoxy)methyl]-1,3-thiazol-5-yl]methanamine |
|---|---|
| PubChem CID | 82298972 |
| Molecular Formula | C11H11ClN2OS |
| Molecular Weight | 254.74 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | [2-[(2-chlorophenoxy)methyl]-1,3-thiazol-5-yl]methanamine |
| SMILES | NCc1cnc(COc2ccccc2Cl)s1 |
| InChI | InChI=1S/C11H11ClN2OS/c12-9-3-1-2-4-10(9)15-7-11-14-6-8(5-13)16-11/h1-4,6H,5,7,13H2 |
| InChIKey | QQEPARIQRBTXRI-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.74 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |