C12H12ClNO2S — CID 94279929
2-[2-[(2-chlorophenoxy)methyl]-1,3-thiazol-4-yl]ethanol (PubChem CID 94279929) has the molecular formula C12H12ClNO2S and a molecular weight of 269.75 g/mol. Its IUPAC name is 2-[2-[(2-chlorophenoxy)methyl]-1,3-thiazol-4-yl]ethanol.
| Compound Name | 2-[2-[(2-chlorophenoxy)methyl]-1,3-thiazol-4-yl]ethanol |
|---|---|
| PubChem CID | 94279929 |
| Molecular Formula | C12H12ClNO2S |
| Molecular Weight | 269.75 g/mol |
| Exact Mass | 269.03 |
| IUPAC Name | 2-[2-[(2-chlorophenoxy)methyl]-1,3-thiazol-4-yl]ethanol |
| SMILES | OCCc1csc(COc2ccccc2Cl)n1 |
| InChI | InChI=1S/C12H12ClNO2S/c13-10-3-1-2-4-11(10)16-7-12-14-9(5-6-15)8-17-12/h1-4,8,15H,5-7H2 |
| InChIKey | UUPNSRYVPSPRFF-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.75 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |