C13H14ClNO2S — CID 82154477
[2-[3-(2-chlorophenoxy)propyl]-1,3-thiazol-4-yl]methanol (PubChem CID 82154477) has the molecular formula C13H14ClNO2S and a molecular weight of 283.78 g/mol. Its IUPAC name is [2-[3-(2-chlorophenoxy)propyl]-1,3-thiazol-4-yl]methanol.
| Compound Name | [2-[3-(2-chlorophenoxy)propyl]-1,3-thiazol-4-yl]methanol |
|---|---|
| PubChem CID | 82154477 |
| Molecular Formula | C13H14ClNO2S |
| Molecular Weight | 283.78 g/mol |
| Exact Mass | 283.04 |
| IUPAC Name | [2-[3-(2-chlorophenoxy)propyl]-1,3-thiazol-4-yl]methanol |
| SMILES | OCc1csc(CCCOc2ccccc2Cl)n1 |
| InChI | InChI=1S/C13H14ClNO2S/c14-11-4-1-2-5-12(11)17-7-3-6-13-15-10(8-16)9-18-13/h1-2,4-5,9,16H,3,6-8H2 |
| InChIKey | KETZUEMOSXWORZ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.78 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|