C16H15NO2S — CID 82154533
[2-(2-naphthalen-2-yloxyethyl)-1,3-thiazol-4-yl]methanol (PubChem CID 82154533) has the molecular formula C16H15NO2S and a molecular weight of 285.37 g/mol. Its IUPAC name is [2-(2-naphthalen-2-yloxyethyl)-1,3-thiazol-4-yl]methanol.
| Compound Name | [2-(2-naphthalen-2-yloxyethyl)-1,3-thiazol-4-yl]methanol |
|---|---|
| PubChem CID | 82154533 |
| Molecular Formula | C16H15NO2S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | [2-(2-naphthalen-2-yloxyethyl)-1,3-thiazol-4-yl]methanol |
| SMILES | OCc1csc(CCOc2ccc3ccccc3c2)n1 |
| InChI | InChI=1S/C16H15NO2S/c18-10-14-11-20-16(17-14)7-8-19-15-6-5-12-3-1-2-4-13(12)9-15/h1-6,9,11,18H,7-8,10H2 |
| InChIKey | ZVNQDCXYEHSPCX-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |