C13H12FNO3S — CID 82154388
2-[2-[2-(3-fluorophenoxy)ethyl]-1,3-thiazol-4-yl]acetic acid (PubChem CID 82154388) has the molecular formula C13H12FNO3S and a molecular weight of 281.31 g/mol. Its IUPAC name is 2-[2-[2-(3-fluorophenoxy)ethyl]-1,3-thiazol-4-yl]acetic acid.
| Compound Name | 2-[2-[2-(3-fluorophenoxy)ethyl]-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 82154388 |
| Molecular Formula | C13H12FNO3S |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | 2-[2-[2-(3-fluorophenoxy)ethyl]-1,3-thiazol-4-yl]acetic acid |
| SMILES | O=C(O)Cc1csc(CCOc2cccc(F)c2)n1 |
| InChI | InChI=1S/C13H12FNO3S/c14-9-2-1-3-11(6-9)18-5-4-12-15-10(8-19-12)7-13(16)17/h1-3,6,8H,4-5,7H2,(H,16,17) |
| InChIKey | CEUGJENAYQZSRC-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |