2-[2-[4-(4-chlorophenoxy)butyl]-1,3-thiazol-4-yl]acetic acid

C15H16ClNO3S — CID 82070583

IUPAC2-[2-[4-(4-chlorophenoxy)butyl]-1,3-thiazol-4-yl]acetic acid
SMILESO=C(O)Cc1csc(CCCCOc2ccc(Cl)cc2)n1
InChIInChI=1S/C15H16ClNO3S/c16-11-4-6-13(7-5-11)20-8-2-1-3-14-17-12(10-21-14)9-15(18)19/h4-7,10H,1-3,8-9H2,(H,18,19)
InChIKeyDNHKALRBTCZDTG-UHFFFAOYSA-N
MW325.82 g/mol
LogP3.83
Rot. Bonds8

About 2-[2-[4-(4-chlorophenoxy)butyl]-1,3-thiazol-4-yl]acetic acid

2-[2-[4-(4-chlorophenoxy)butyl]-1,3-thiazol-4-yl]acetic acid (PubChem CID 82070583) has the molecular formula C15H16ClNO3S and a molecular weight of 325.82 g/mol. Its IUPAC name is 2-[2-[4-(4-chlorophenoxy)butyl]-1,3-thiazol-4-yl]acetic acid.

Molecular Properties

Compound Name2-[2-[4-(4-chlorophenoxy)butyl]-1,3-thiazol-4-yl]acetic acid
PubChem CID82070583
Molecular FormulaC15H16ClNO3S
Molecular Weight325.82 g/mol
Exact Mass325.05
IUPAC Name2-[2-[4-(4-chlorophenoxy)butyl]-1,3-thiazol-4-yl]acetic acid
SMILESO=C(O)Cc1csc(CCCCOc2ccc(Cl)cc2)n1
InChIInChI=1S/C15H16ClNO3S/c16-11-4-6-13(7-5-11)20-8-2-1-3-14-17-12(10-21-14)9-15(18)19/h4-7,10H,1-3,8-9H2,(H,18,19)
InChIKeyDNHKALRBTCZDTG-UHFFFAOYSA-N
XLogP3.83
TPSA59.42 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds8
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500325.82
LogP ≤ 53.83
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-[2-[4-(4-chlorophenoxy)butyl]-1,3-thiazol-4-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-[4-(4-chlorophenoxy)butyl]-1,3-thiazol-4-yl]acetic acid?
The IUPAC name of 2-[2-[4-(4-chlorophenoxy)butyl]-1,3-thiazol-4-yl]acetic acid (CID 82070583) is 2-[2-[4-(4-chlorophenoxy)butyl]-1,3-thiazol-4-yl]acetic acid.
What is the SMILES notation for 2-[2-[4-(4-chlorophenoxy)butyl]-1,3-thiazol-4-yl]acetic acid?
The canonical SMILES for 2-[2-[4-(4-chlorophenoxy)butyl]-1,3-thiazol-4-yl]acetic acid is O=C(O)Cc1csc(CCCCOc2ccc(Cl)cc2)n1.
What is the InChIKey of 2-[2-[4-(4-chlorophenoxy)butyl]-1,3-thiazol-4-yl]acetic acid?
The InChIKey is DNHKALRBTCZDTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16ClNO3S/c16-11-4-6-13(7-5-11)20-8-2-1-3-14-17-12(10-21-14)9-15(18)19/h4-7,10H,1-3,8-9H2,(H,18,19).
What are the key properties of 2-[2-[4-(4-chlorophenoxy)butyl]-1,3-thiazol-4-yl]acetic acid?
2-[2-[4-(4-chlorophenoxy)butyl]-1,3-thiazol-4-yl]acetic acid has a molecular weight of 325.82 g/mol, XLogP of 3.83, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[4-(4-chlorophenoxy)butyl]-1,3-thiazol-4-yl]acetic acid is sourced from PubChem (CID 82070583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).