C14H12ClNO3S — CID 82516273
(E)-3-[2-[2-(4-chlorophenoxy)ethyl]-1,3-thiazol-4-yl]prop-2-enoic acid (PubChem CID 82516273) has the molecular formula C14H12ClNO3S and a molecular weight of 309.77 g/mol. Its IUPAC name is (E)-3-[2-[2-(4-chlorophenoxy)ethyl]-1,3-thiazol-4-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-[2-(4-chlorophenoxy)ethyl]-1,3-thiazol-4-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 82516273 |
| Molecular Formula | C14H12ClNO3S |
| Molecular Weight | 309.77 g/mol |
| Exact Mass | 309.02 |
| IUPAC Name | (E)-3-[2-[2-(4-chlorophenoxy)ethyl]-1,3-thiazol-4-yl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1csc(CCOc2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C14H12ClNO3S/c15-10-1-4-12(5-2-10)19-8-7-13-16-11(9-20-13)3-6-14(17)18/h1-6,9H,7-8H2,(H,17,18)/b6-3+ |
| InChIKey | BXZZJJCCLOWCDX-ZZXKWVIFSA-N |
| XLogP | 3.52 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.77 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|