C12H22N2S — CID 101037825
(1S)-1-(5-hexyl-1,3-thiazol-2-yl)propan-1-amine (PubChem CID 101037825) has the molecular formula C12H22N2S and a molecular weight of 226.39 g/mol. Its IUPAC name is (1S)-1-(5-hexyl-1,3-thiazol-2-yl)propan-1-amine.
| Compound Name | (1S)-1-(5-hexyl-1,3-thiazol-2-yl)propan-1-amine |
|---|---|
| PubChem CID | 101037825 |
| Molecular Formula | C12H22N2S |
| Molecular Weight | 226.39 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | (1S)-1-(5-hexyl-1,3-thiazol-2-yl)propan-1-amine |
| SMILES | CCCCCCc1cnc([C@@H](N)CC)s1 |
| InChI | InChI=1S/C12H22N2S/c1-3-5-6-7-8-10-9-14-12(15-10)11(13)4-2/h9,11H,3-8,13H2,1-2H3/t11-/m0/s1 |
| InChIKey | QUQBOXRTJXSTGU-NSHDSACASA-N |
| XLogP | 3.68 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.39 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|