C20H30N2O4S2 — CID 139349558
ethyl 5-pentyl-1,3-thiazole-2-carboxylate;5-pentyl-1,3-thiazole-2-carboxylic acid (PubChem CID 139349558) has the molecular formula C20H30N2O4S2 and a molecular weight of 426.60 g/mol. Its IUPAC name is ethyl 5-pentyl-1,3-thiazole-2-carboxylate;5-pentyl-1,3-thiazole-2-carboxylic acid.
| Compound Name | ethyl 5-pentyl-1,3-thiazole-2-carboxylate;5-pentyl-1,3-thiazole-2-carboxylic acid |
|---|---|
| PubChem CID | 139349558 |
| Molecular Formula | C20H30N2O4S2 |
| Molecular Weight | 426.60 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | ethyl 5-pentyl-1,3-thiazole-2-carboxylate;5-pentyl-1,3-thiazole-2-carboxylic acid |
| SMILES | CCCCCc1cnc(C(=O)O)s1.CCCCCc1cnc(C(=O)OCC)s1 |
| InChI | InChI=1S/C11H17NO2S.C9H13NO2S/c1-3-5-6-7-9-8-12-10(15-9)11(13)14-4-2;1-2-3-4-5-7-6-10-8(13-7)9(11)12/h8H,3-7H2,1-2H3;6H,2-5H2,1H3,(H,11,12) |
| InChIKey | URMMFCYLLHRZAU-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 89.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.60 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|